Wolfram|Alpha Chemistry

Chemical Compounds

Compounds

get information about a chemical compound
octane H2SO4 eicosapentaenoic acid dopamine
specify a compound by chemical identifier
InChI=1/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 CAS 287-23-0
compare several compounds
methanol, ethanol, isopropanol
mix together different elements to create a compound
7.31 grams C + 0.737 grams H + 1.95 grams O

Classes of Compounds

get information about a class of compounds
alkyne
analyze properties of a class of compounds
boiling point of perfluorocarbons alkyl halides partition coefficient
analyze correlations between properties of a class of compounds
aromatic hydrocarbons density vs molar mass

Properties of Compounds

request a property of a chemical compound
benzene viscosity combustion heat of C3H8 enthalpy of hydration of acetic acid energy content of H2 3-amino-4-chlorobenzoic acid molecular properties
compare properties of multiple compounds
flash point methane, butane, octane
do computations with chemical properties
viscosity glycerol / methanol
compute different molecular structures
lactic acid structure diagram
compute a property at a specified temperature
surface tension of hexadecane at 25C electrical resistivity of gold at 10K vapor pressure of BaCl2 at 10C
find a threshold limit value
tlv of pentane
find the speed of sound in a chemical
How fast does sound travel in chloroform?
find a UV cutoff wavelength for a chemical
benzene absorbs light up to what wavelength
look up an identifier for a compound
InChI for isobutyl alcohol